C16H16FNO3S2 — CID 7676164
[2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(2-fluorophenyl)sulfanylacetate (PubChem CID 7676164) has the molecular formula C16H16FNO3S2 and a molecular weight of 353.44 g/mol. Its IUPAC name is [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(2-fluorophenyl)sulfanylacetate.
| Compound Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(2-fluorophenyl)sulfanylacetate |
|---|---|
| PubChem CID | 7676164 |
| Molecular Formula | C16H16FNO3S2 |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | [2-oxo-2-[[(1R)-1-thiophen-2-ylethyl]amino]ethyl] 2-(2-fluorophenyl)sulfanylacetate |
| SMILES | C[C@@H](NC(=O)COC(=O)CSc1ccccc1F)c1cccs1 |
| InChI | InChI=1S/C16H16FNO3S2/c1-11(13-7-4-8-22-13)18-15(19)9-21-16(20)10-23-14-6-3-2-5-12(14)17/h2-8,11H,9-10H2,1H3,(H,18,19)/t11-/m1/s1 |
| InChIKey | FBOBAGVKTLQYNE-LLVKDONJSA-N |
| XLogP | 3.40 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |