C15H15ClN2O3S — CID 17395295
[2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-amino-5-chlorobenzoate (PubChem CID 17395295) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-amino-5-chlorobenzoate.
| Compound Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-amino-5-chlorobenzoate |
|---|---|
| PubChem CID | 17395295 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | [2-oxo-2-(1-thiophen-2-ylethylamino)ethyl] 2-amino-5-chlorobenzoate |
| SMILES | CC(NC(=O)COC(=O)c1cc(Cl)ccc1N)c1cccs1 |
| InChI | InChI=1S/C15H15ClN2O3S/c1-9(13-3-2-6-22-13)18-14(19)8-21-15(20)11-7-10(16)4-5-12(11)17/h2-7,9H,8,17H2,1H3,(H,18,19) |
| InChIKey | UTQNVMKBTYNHJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|