C22H27NO7 — CID 42965974
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(2-ethoxyphenoxy)butanoate (PubChem CID 42965974) has the molecular formula C22H27NO7 and a molecular weight of 417.46 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(2-ethoxyphenoxy)butanoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(2-ethoxyphenoxy)butanoate |
|---|---|
| PubChem CID | 42965974 |
| Molecular Formula | C22H27NO7 |
| Molecular Weight | 417.46 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(2-ethoxyphenoxy)butanoate |
| SMILES | CCOc1ccccc1OCCCC(=O)OCC(=O)Nc1cc(OC)cc(OC)c1 |
| InChI | InChI=1S/C22H27NO7/c1-4-28-19-8-5-6-9-20(19)29-11-7-10-22(25)30-15-21(24)23-16-12-17(26-2)14-18(13-16)27-3/h5-6,8-9,12-14H,4,7,10-11,15H2,1-3H3,(H,23,24) |
| InChIKey | SLXXROXCFNPGFD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|