C18H19NO7 — CID 23883804
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-(2-hydroxyphenoxy)acetate (PubChem CID 23883804) has the molecular formula C18H19NO7 and a molecular weight of 361.35 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-(2-hydroxyphenoxy)acetate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-(2-hydroxyphenoxy)acetate |
|---|---|
| PubChem CID | 23883804 |
| Molecular Formula | C18H19NO7 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 2-(2-hydroxyphenoxy)acetate |
| SMILES | COc1cc(NC(=O)COC(=O)COc2ccccc2O)cc(OC)c1 |
| InChI | InChI=1S/C18H19NO7/c1-23-13-7-12(8-14(9-13)24-2)19-17(21)10-26-18(22)11-25-16-6-4-3-5-15(16)20/h3-9,20H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | FDDFXTFBTXWESD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |