C17H18N2O5 — CID 23859785
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-aminobenzoate (PubChem CID 23859785) has the molecular formula C17H18N2O5 and a molecular weight of 330.34 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-aminobenzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-aminobenzoate |
|---|---|
| PubChem CID | 23859785 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-aminobenzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(N)cc2)cc(OC)c1 |
| InChI | InChI=1S/C17H18N2O5/c1-22-14-7-13(8-15(9-14)23-2)19-16(20)10-24-17(21)11-3-5-12(18)6-4-11/h3-9H,10,18H2,1-2H3,(H,19,20) |
| InChIKey | LBGKXVVLVQEQGP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|