C18H17F2NO6 — CID 2613656
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)benzoate (PubChem CID 2613656) has the molecular formula C18H17F2NO6 and a molecular weight of 381.33 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)benzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
|---|---|
| PubChem CID | 2613656 |
| Molecular Formula | C18H17F2NO6 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(difluoromethoxy)benzoate |
| SMILES | COc1cc(NC(=O)COC(=O)c2ccc(OC(F)F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C18H17F2NO6/c1-24-14-7-12(8-15(9-14)25-2)21-16(22)10-26-17(23)11-3-5-13(6-4-11)27-18(19)20/h3-9,18H,10H2,1-2H3,(H,21,22) |
| InChIKey | XBPXSHZIJSEVQY-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |