C21H26N2O5 — CID 2515065
[2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(diethylamino)benzoate (PubChem CID 2515065) has the molecular formula C21H26N2O5 and a molecular weight of 386.45 g/mol. Its IUPAC name is [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(diethylamino)benzoate.
| Compound Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(diethylamino)benzoate |
|---|---|
| PubChem CID | 2515065 |
| Molecular Formula | C21H26N2O5 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | [2-(3,5-dimethoxyanilino)-2-oxoethyl] 4-(diethylamino)benzoate |
| SMILES | CCN(CC)c1ccc(C(=O)OCC(=O)Nc2cc(OC)cc(OC)c2)cc1 |
| InChI | InChI=1S/C21H26N2O5/c1-5-23(6-2)17-9-7-15(8-10-17)21(25)28-14-20(24)22-16-11-18(26-3)13-19(12-16)27-4/h7-13H,5-6,14H2,1-4H3,(H,22,24) |
| InChIKey | LRLFFZFIEFNXPX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |