C20H19ClN2O5 — CID 7856589
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate (PubChem CID 7856589) has the molecular formula C20H19ClN2O5 and a molecular weight of 402.83 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
|---|---|
| PubChem CID | 7856589 |
| Molecular Formula | C20H19ClN2O5 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-(2-ethoxyphenoxy)propanoate |
| SMILES | CCOc1ccccc1OCCC(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C20H19ClN2O5/c1-2-26-17-5-3-4-6-18(17)27-10-9-20(25)28-13-19(24)23-15-8-7-14(12-22)16(21)11-15/h3-8,11H,2,9-10,13H2,1H3,(H,23,24) |
| InChIKey | SARQPOSFZICJOE-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |