C22H20BrNO2 — CID 2233417
2-(4-bromo-2,5-dimethylphenoxy)-N-(2-phenylphenyl)acetamide (PubChem CID 2233417) has the molecular formula C22H20BrNO2 and a molecular weight of 410.31 g/mol. Its IUPAC name is 2-(4-bromo-2,5-dimethylphenoxy)-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 2233417 |
| Molecular Formula | C22H20BrNO2 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-(4-bromo-2,5-dimethylphenoxy)-N-(2-phenylphenyl)acetamide |
| SMILES | Cc1cc(OCC(=O)Nc2ccccc2-c2ccccc2)c(C)cc1Br |
| InChI | InChI=1S/C22H20BrNO2/c1-15-13-21(16(2)12-19(15)23)26-14-22(25)24-20-11-7-6-10-18(20)17-8-4-3-5-9-17/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | VVZYOUXBTLHUGT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |