C19H19Cl3N2O2 — CID 6048682
N-[(E)-(3-methyl-1-phenylbutylidene)amino]-2-(2,4,5-trichlorophenoxy)acetamide (PubChem CID 6048682) has the molecular formula C19H19Cl3N2O2 and a molecular weight of 413.73 g/mol. Its IUPAC name is N-[(E)-(3-methyl-1-phenylbutylidene)amino]-2-(2,4,5-trichlorophenoxy)acetamide.
| Compound Name | N-[(E)-(3-methyl-1-phenylbutylidene)amino]-2-(2,4,5-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 6048682 |
| Molecular Formula | C19H19Cl3N2O2 |
| Molecular Weight | 413.73 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | N-[(E)-(3-methyl-1-phenylbutylidene)amino]-2-(2,4,5-trichlorophenoxy)acetamide |
| SMILES | CC(C)C/C(=N\NC(=O)COc1cc(Cl)c(Cl)cc1Cl)c1ccccc1 |
| InChI | InChI=1S/C19H19Cl3N2O2/c1-12(2)8-17(13-6-4-3-5-7-13)23-24-19(25)11-26-18-10-15(21)14(20)9-16(18)22/h3-7,9-10,12H,8,11H2,1-2H3,(H,24,25)/b23-17+ |
| InChIKey | CABATXRISBBZFQ-HAVVHWLPSA-N |
| XLogP | 5.59 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.73 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|