C25H28N4O3S — CID 16546756
4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(3-methylphenoxy)butanoyl]benzohydrazide (PubChem CID 16546756) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(3-methylphenoxy)butanoyl]benzohydrazide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(3-methylphenoxy)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 16546756 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(3-methylphenoxy)butanoyl]benzohydrazide |
| SMILES | Cc1cccc(OCCCC(=O)NNC(=O)c2ccc(CSc3nc(C)cc(C)n3)cc2)c1 |
| InChI | InChI=1S/C25H28N4O3S/c1-17-6-4-7-22(14-17)32-13-5-8-23(30)28-29-24(31)21-11-9-20(10-12-21)16-33-25-26-18(2)15-19(3)27-25/h4,6-7,9-12,14-15H,5,8,13,16H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | QHYYEGJNXNDEBL-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|