C22H19F3N4O2S — CID 16546762
4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide (PubChem CID 16546762) has the molecular formula C22H19F3N4O2S and a molecular weight of 460.48 g/mol. Its IUPAC name is 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide.
| Compound Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 16546762 |
| Molecular Formula | C22H19F3N4O2S |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | 4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]-N'-[4-(trifluoromethyl)benzoyl]benzohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)c3ccc(C(F)(F)F)cc3)cc2)n1 |
| InChI | InChI=1S/C22H19F3N4O2S/c1-13-11-14(2)27-21(26-13)32-12-15-3-5-16(6-4-15)19(30)28-29-20(31)17-7-9-18(10-8-17)22(23,24)25/h3-11H,12H2,1-2H3,(H,28,30)(H,29,31) |
| InChIKey | JCOSMDWJRGNICG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|