C25H23N5O2S2 — CID 24640496
N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide (PubChem CID 24640496) has the molecular formula C25H23N5O2S2 and a molecular weight of 489.63 g/mol. Its IUPAC name is N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide.
| Compound Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 24640496 |
| Molecular Formula | C25H23N5O2S2 |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.13 |
| IUPAC Name | N'-[4-[(4,6-dimethylpyrimidin-2-yl)sulfanylmethyl]benzoyl]-2-methyl-4-phenyl-1,3-thiazole-5-carbohydrazide |
| SMILES | Cc1cc(C)nc(SCc2ccc(C(=O)NNC(=O)c3sc(C)nc3-c3ccccc3)cc2)n1 |
| InChI | InChI=1S/C25H23N5O2S2/c1-15-13-16(2)27-25(26-15)33-14-18-9-11-20(12-10-18)23(31)29-30-24(32)22-21(28-17(3)34-22)19-7-5-4-6-8-19/h4-13H,14H2,1-3H3,(H,29,31)(H,30,32) |
| InChIKey | XILWXYPDGIDSET-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|