C18H20N2O4S — CID 9496112
3,5-dimethoxy-N'-[(2R)-2-phenylsulfanylpropanoyl]benzohydrazide (PubChem CID 9496112) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3,5-dimethoxy-N'-[(2R)-2-phenylsulfanylpropanoyl]benzohydrazide.
| Compound Name | 3,5-dimethoxy-N'-[(2R)-2-phenylsulfanylpropanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9496112 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3,5-dimethoxy-N'-[(2R)-2-phenylsulfanylpropanoyl]benzohydrazide |
| SMILES | COc1cc(OC)cc(C(=O)NNC(=O)[C@@H](C)Sc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-12(25-16-7-5-4-6-8-16)17(21)19-20-18(22)13-9-14(23-2)11-15(10-13)24-3/h4-12H,1-3H3,(H,19,21)(H,20,22)/t12-/m1/s1 |
| InChIKey | RQCFYYYSPCEMOP-GFCCVEGCSA-N |
| XLogP | 2.65 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|