C27H29N3O7S — CID 4842709
3,4,5-triethoxy-N'-[4-(4-methylphenyl)sulfanyl-3-nitrobenzoyl]benzohydrazide (PubChem CID 4842709) has the molecular formula C27H29N3O7S and a molecular weight of 539.61 g/mol. Its IUPAC name is 3,4,5-triethoxy-N'-[4-(4-methylphenyl)sulfanyl-3-nitrobenzoyl]benzohydrazide.
| Compound Name | 3,4,5-triethoxy-N'-[4-(4-methylphenyl)sulfanyl-3-nitrobenzoyl]benzohydrazide |
|---|---|
| PubChem CID | 4842709 |
| Molecular Formula | C27H29N3O7S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 3,4,5-triethoxy-N'-[4-(4-methylphenyl)sulfanyl-3-nitrobenzoyl]benzohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2ccc(Sc3ccc(C)cc3)c([N+](=O)[O-])c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H29N3O7S/c1-5-35-22-15-19(16-23(36-6-2)25(22)37-7-3)27(32)29-28-26(31)18-10-13-24(21(14-18)30(33)34)38-20-11-8-17(4)9-12-20/h8-16H,5-7H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | SDLYCQOXMVXHQO-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|