C17H15F2NO6S — CID 2103060
[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 3-(methylsulfamoyl)benzoate (PubChem CID 2103060) has the molecular formula C17H15F2NO6S and a molecular weight of 399.37 g/mol. Its IUPAC name is [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 3-(methylsulfamoyl)benzoate.
| Compound Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2103060 |
| Molecular Formula | C17H15F2NO6S |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | [2-[4-(difluoromethoxy)phenyl]-2-oxoethyl] 3-(methylsulfamoyl)benzoate |
| SMILES | CNS(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C17H15F2NO6S/c1-20-27(23,24)14-4-2-3-12(9-14)16(22)25-10-15(21)11-5-7-13(8-6-11)26-17(18)19/h2-9,17,20H,10H2,1H3 |
| InChIKey | CXMPHYBFMMMSPK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |