C19H21NO6S — CID 7536992
[2-(4-methoxyphenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate (PubChem CID 7536992) has the molecular formula C19H21NO6S and a molecular weight of 391.45 g/mol. Its IUPAC name is [2-(4-methoxyphenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate.
| Compound Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7536992 |
| Molecular Formula | C19H21NO6S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | [2-(4-methoxyphenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
| SMILES | CCCNS(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C19H21NO6S/c1-3-11-20-27(23,24)17-6-4-5-15(12-17)19(22)26-13-18(21)14-7-9-16(25-2)10-8-14/h4-10,12,20H,3,11,13H2,1-2H3 |
| InChIKey | YLJGQFGXXINAIY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |