C18H17F2NO5S — CID 7536885
[2-(3,4-difluorophenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate (PubChem CID 7536885) has the molecular formula C18H17F2NO5S and a molecular weight of 397.40 g/mol. Its IUPAC name is [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate.
| Compound Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 7536885 |
| Molecular Formula | C18H17F2NO5S |
| Molecular Weight | 397.40 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | [2-(3,4-difluorophenyl)-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
| SMILES | CCCNS(=O)(=O)c1cccc(C(=O)OCC(=O)c2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C18H17F2NO5S/c1-2-8-21-27(24,25)14-5-3-4-13(9-14)18(23)26-11-17(22)12-6-7-15(19)16(20)10-12/h3-7,9-10,21H,2,8,11H2,1H3 |
| InChIKey | MSGGPURTGBCPJP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |