C16H23N3O6S — CID 9330312
[2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-(propylsulfamoyl)benzoate (PubChem CID 9330312) has the molecular formula C16H23N3O6S and a molecular weight of 385.44 g/mol. Its IUPAC name is [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-(propylsulfamoyl)benzoate.
| Compound Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 9330312 |
| Molecular Formula | C16H23N3O6S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [2-[[2-(dimethylamino)-2-oxoethyl]amino]-2-oxoethyl] 3-(propylsulfamoyl)benzoate |
| SMILES | CCCNS(=O)(=O)c1cccc(C(=O)OCC(=O)NCC(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H23N3O6S/c1-4-8-18-26(23,24)13-7-5-6-12(9-13)16(22)25-11-14(20)17-10-15(21)19(2)3/h5-7,9,18H,4,8,10-11H2,1-3H3,(H,17,20) |
| InChIKey | ODJGOJIHUYOTGO-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |