C19H18F2N2O5S — CID 46625553
[1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 4-(cyclopropylsulfamoyl)benzoate (PubChem CID 46625553) has the molecular formula C19H18F2N2O5S and a molecular weight of 424.43 g/mol. Its IUPAC name is [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 4-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 4-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 46625553 |
| Molecular Formula | C19H18F2N2O5S |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | [1-(2,4-difluoroanilino)-1-oxopropan-2-yl] 4-(cyclopropylsulfamoyl)benzoate |
| SMILES | CC(OC(=O)c1ccc(S(=O)(=O)NC2CC2)cc1)C(=O)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H18F2N2O5S/c1-11(18(24)22-17-9-4-13(20)10-16(17)21)28-19(25)12-2-7-15(8-3-12)29(26,27)23-14-5-6-14/h2-4,7-11,14,23H,5-6H2,1H3,(H,22,24) |
| InChIKey | XMABADJUFDMGFF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |