C23H25ClN2O4 — CID 38724277
(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]prop-2-enamide (PubChem CID 38724277) has the molecular formula C23H25ClN2O4 and a molecular weight of 428.92 g/mol. Its IUPAC name is (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 38724277 |
| Molecular Formula | C23H25ClN2O4 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | (E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)-N-methyl-N-[(2-morpholin-4-ylphenyl)methyl]prop-2-enamide |
| SMILES | CN(Cc1ccccc1N1CCOCC1)C(=O)/C=C/c1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C23H25ClN2O4/c1-25(16-18-4-2-3-5-20(18)26-8-10-28-11-9-26)22(27)7-6-17-14-19(24)23-21(15-17)29-12-13-30-23/h2-7,14-15H,8-13,16H2,1H3/b7-6+ |
| InChIKey | XBUNMIYMJGHMIX-VOTSOKGWSA-N |
| XLogP | 3.62 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|