C19H17N3O4S — CID 99997359
(E)-3-(1,3-benzodioxol-5-yl)-N-ethyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide (PubChem CID 99997359) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-N-ethyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-N-ethyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99997359 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-N-ethyl-N-[(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)methyl]prop-2-enamide |
| SMILES | CCN(Cc1nc(-c2cccs2)no1)C(=O)/C=C/c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17N3O4S/c1-2-22(11-17-20-19(21-26-17)16-4-3-9-27-16)18(23)8-6-13-5-7-14-15(10-13)25-12-24-14/h3-10H,2,11-12H2,1H3/b8-6+ |
| InChIKey | IAFVIJSRTZQYMK-SOFGYWHQSA-N |
| XLogP | 3.59 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|