C21H18N2O5 — CID 7622554
[3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate (PubChem CID 7622554) has the molecular formula C21H18N2O5 and a molecular weight of 378.38 g/mol. Its IUPAC name is [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate.
| Compound Name | [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7622554 |
| Molecular Formula | C21H18N2O5 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | [3-(2-methylphenyl)-1,2,4-oxadiazol-5-yl]methyl (E)-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enoate |
| SMILES | Cc1ccccc1-c1noc(COC(=O)/C=C/c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C21H18N2O5/c1-14-4-2-3-5-16(14)21-22-19(28-23-21)13-27-20(24)9-7-15-6-8-17-18(12-15)26-11-10-25-17/h2-9,12H,10-11,13H2,1H3/b9-7+ |
| InChIKey | APXPWWRDEVTLNM-VQHVLOKHSA-N |
| XLogP | 3.57 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|