C21H19Cl2N3O4 — CID 99996340
(E)-3-(2,4-dichlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide (PubChem CID 99996340) has the molecular formula C21H19Cl2N3O4 and a molecular weight of 448.31 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 99996340 |
| Molecular Formula | C21H19Cl2N3O4 |
| Molecular Weight | 448.31 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[[3-(2,4-dimethoxyphenyl)-1,2,4-oxadiazol-5-yl]methyl]-N-methylprop-2-enamide |
| SMILES | COc1ccc(-c2noc(CN(C)C(=O)/C=C/c3ccc(Cl)cc3Cl)n2)c(OC)c1 |
| InChI | InChI=1S/C21H19Cl2N3O4/c1-26(20(27)9-5-13-4-6-14(22)10-17(13)23)12-19-24-21(25-30-19)16-8-7-15(28-2)11-18(16)29-3/h4-11H,12H2,1-3H3/b9-5+ |
| InChIKey | GIURMMIMWRZKPK-WEVVVXLNSA-N |
| XLogP | 4.73 |
| TPSA | 77.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.31 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|