C17H25ClN2O4 — CID 7702937
2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N,N-di(propan-2-yl)acetamide (PubChem CID 7702937) has the molecular formula C17H25ClN2O4 and a molecular weight of 356.85 g/mol. Its IUPAC name is 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N,N-di(propan-2-yl)acetamide.
| Compound Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N,N-di(propan-2-yl)acetamide |
|---|---|
| PubChem CID | 7702937 |
| Molecular Formula | C17H25ClN2O4 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N,N-di(propan-2-yl)acetamide |
| SMILES | COc1cc(/C=N\OCC(=O)N(C(C)C)C(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C17H25ClN2O4/c1-11(2)20(12(3)4)16(21)10-24-19-9-13-7-14(18)17(23-6)15(8-13)22-5/h7-9,11-12H,10H2,1-6H3/b19-9- |
| InChIKey | YKSQMLJQPKBCDU-OCKHKDLRSA-N |
| XLogP | 3.35 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|