C18H24ClN3O5 — CID 7702990
2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(cyclohexylcarbamoyl)acetamide (PubChem CID 7702990) has the molecular formula C18H24ClN3O5 and a molecular weight of 397.86 g/mol. Its IUPAC name is 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(cyclohexylcarbamoyl)acetamide.
| Compound Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(cyclohexylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7702990 |
| Molecular Formula | C18H24ClN3O5 |
| Molecular Weight | 397.86 g/mol |
| Exact Mass | 397.14 |
| IUPAC Name | 2-[(Z)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-N-(cyclohexylcarbamoyl)acetamide |
| SMILES | COc1cc(/C=N\OCC(=O)NC(=O)NC2CCCCC2)cc(Cl)c1OC |
| InChI | InChI=1S/C18H24ClN3O5/c1-25-15-9-12(8-14(19)17(15)26-2)10-20-27-11-16(23)22-18(24)21-13-6-4-3-5-7-13/h8-10,13H,3-7,11H2,1-2H3,(H2,21,22,23,24)/b20-10- |
| InChIKey | WTXBELRKGQUZDH-JMIUGGIZSA-N |
| XLogP | 2.87 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.86 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|