C22H25ClN2O6 — CID 24608098
2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone (PubChem CID 24608098) has the molecular formula C22H25ClN2O6 and a molecular weight of 448.90 g/mol. Its IUPAC name is 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone.
| Compound Name | 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
|---|---|
| PubChem CID | 24608098 |
| Molecular Formula | C22H25ClN2O6 |
| Molecular Weight | 448.90 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | 2-[(E)-(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxy-1-(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)ethanone |
| SMILES | COc1cc2c(cc1OC)CN(C(=O)CO/N=C/c1cc(Cl)c(OC)c(OC)c1)CC2 |
| InChI | InChI=1S/C22H25ClN2O6/c1-27-18-9-15-5-6-25(12-16(15)10-19(18)28-2)21(26)13-31-24-11-14-7-17(23)22(30-4)20(8-14)29-3/h7-11H,5-6,12-13H2,1-4H3/b24-11+ |
| InChIKey | ROMJCTVQLIGPNX-BHGWPJFGSA-N |
| XLogP | 3.31 |
| TPSA | 78.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.90 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|