C22H27ClN2O4 — CID 2440644
N-benzyl-N-tert-butyl-2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetamide (PubChem CID 2440644) has the molecular formula C22H27ClN2O4 and a molecular weight of 418.92 g/mol. Its IUPAC name is N-benzyl-N-tert-butyl-2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetamide.
| Compound Name | N-benzyl-N-tert-butyl-2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetamide |
|---|---|
| PubChem CID | 2440644 |
| Molecular Formula | C22H27ClN2O4 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.17 |
| IUPAC Name | N-benzyl-N-tert-butyl-2-[(3-chloro-4,5-dimethoxyphenyl)methylideneamino]oxyacetamide |
| SMILES | COc1cc(C=NOCC(=O)N(Cc2ccccc2)C(C)(C)C)cc(Cl)c1OC |
| InChI | InChI=1S/C22H27ClN2O4/c1-22(2,3)25(14-16-9-7-6-8-10-16)20(26)15-29-24-13-17-11-18(23)21(28-5)19(12-17)27-4/h6-13H,14-15H2,1-5H3 |
| InChIKey | JZGXYTCYRVDBQG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|