C21H20ClN3O4S — CID 55825308
2-chloro-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]quinoline-6-carboxamide (PubChem CID 55825308) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is 2-chloro-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]quinoline-6-carboxamide.
| Compound Name | 2-chloro-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]quinoline-6-carboxamide |
|---|---|
| PubChem CID | 55825308 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 2-chloro-N-[(4-morpholin-4-ylsulfonylphenyl)methyl]quinoline-6-carboxamide |
| SMILES | O=C(NCc1ccc(S(=O)(=O)N2CCOCC2)cc1)c1ccc2nc(Cl)ccc2c1 |
| InChI | InChI=1S/C21H20ClN3O4S/c22-20-8-4-16-13-17(3-7-19(16)24-20)21(26)23-14-15-1-5-18(6-2-15)30(27,28)25-9-11-29-12-10-25/h1-8,13H,9-12,14H2,(H,23,26) |
| InChIKey | IUMSDIOMVNLGQU-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|