C18H22ClN3O5S — CID 46423561
N-(3-chloro-4-propan-2-yloxyphenyl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 46423561) has the molecular formula C18H22ClN3O5S and a molecular weight of 427.91 g/mol. Its IUPAC name is N-(3-chloro-4-propan-2-yloxyphenyl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-(3-chloro-4-propan-2-yloxyphenyl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46423561 |
| Molecular Formula | C18H22ClN3O5S |
| Molecular Weight | 427.91 g/mol |
| Exact Mass | 427.10 |
| IUPAC Name | N-(3-chloro-4-propan-2-yloxyphenyl)-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)Oc1ccc(NC(=O)c2cc(S(=O)(=O)N3CCOCC3)c[nH]2)cc1Cl |
| InChI | InChI=1S/C18H22ClN3O5S/c1-12(2)27-17-4-3-13(9-15(17)19)21-18(23)16-10-14(11-20-16)28(24,25)22-5-7-26-8-6-22/h3-4,9-12,20H,5-8H2,1-2H3,(H,21,23) |
| InChIKey | OEACGHKBDIYBGS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.91 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |