C19H24ClN3O4S — CID 46513564
N-[1-(4-chlorophenyl)-2-methylpropyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide (PubChem CID 46513564) has the molecular formula C19H24ClN3O4S and a molecular weight of 425.94 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-methylpropyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-methylpropyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 46513564 |
| Molecular Formula | C19H24ClN3O4S |
| Molecular Weight | 425.94 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-methylpropyl]-4-morpholin-4-ylsulfonyl-1H-pyrrole-2-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cc(S(=O)(=O)N2CCOCC2)c[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H24ClN3O4S/c1-13(2)18(14-3-5-15(20)6-4-14)22-19(24)17-11-16(12-21-17)28(25,26)23-7-9-27-10-8-23/h3-6,11-13,18,21H,7-10H2,1-2H3,(H,22,24) |
| InChIKey | QDJAHLYMNYMNNB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.94 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |