C21H21F2N3O3S2 — CID 75467301
N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 75467301) has the molecular formula C21H21F2N3O3S2 and a molecular weight of 465.55 g/mol. Its IUPAC name is N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 75467301 |
| Molecular Formula | C21H21F2N3O3S2 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.10 |
| IUPAC Name | N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(2,5-difluorophenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | N#CCCSc1ccccc1NC(=O)C1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C21H21F2N3O3S2/c22-16-6-7-17(23)20(14-16)31(28,29)26-11-8-15(9-12-26)21(27)25-18-4-1-2-5-19(18)30-13-3-10-24/h1-2,4-7,14-15H,3,8-9,11-13H2,(H,25,27) |
| InChIKey | VGRSAACCVCIBGC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|