C20H20FN3O3S2 — CID 97309349
(2S)-N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide (PubChem CID 97309349) has the molecular formula C20H20FN3O3S2 and a molecular weight of 433.53 g/mol. Its IUPAC name is (2S)-N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 97309349 |
| Molecular Formula | C20H20FN3O3S2 |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | (2S)-N-[2-(2-cyanoethylsulfanyl)phenyl]-1-(4-fluorophenyl)sulfonylpyrrolidine-2-carboxamide |
| SMILES | N#CCCSc1ccccc1NC(=O)[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H20FN3O3S2/c21-15-8-10-16(11-9-15)29(26,27)24-13-3-6-18(24)20(25)23-17-5-1-2-7-19(17)28-14-4-12-22/h1-2,5,7-11,18H,3-4,6,13-14H2,(H,23,25)/t18-/m0/s1 |
| InChIKey | PPFVUIRSFXGITL-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|