C17H17FN4O5S — CID 26720866
(2S)-1-(4-fluorophenyl)sulfonyl-N'-(2-nitrophenyl)pyrrolidine-2-carbohydrazide (PubChem CID 26720866) has the molecular formula C17H17FN4O5S and a molecular weight of 408.41 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)sulfonyl-N'-(2-nitrophenyl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2S)-1-(4-fluorophenyl)sulfonyl-N'-(2-nitrophenyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 26720866 |
| Molecular Formula | C17H17FN4O5S |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)sulfonyl-N'-(2-nitrophenyl)pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNc1ccccc1[N+](=O)[O-])[C@@H]1CCCN1S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17FN4O5S/c18-12-7-9-13(10-8-12)28(26,27)21-11-3-6-16(21)17(23)20-19-14-4-1-2-5-15(14)22(24)25/h1-2,4-5,7-10,16,19H,3,6,11H2,(H,20,23)/t16-/m0/s1 |
| InChIKey | DYWJNAFSEJHSRO-INIZCTEOSA-N |
| XLogP | 2.03 |
| TPSA | 121.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|