C17H18FN3O3S — CID 51935537
(2R)-1-(benzenesulfonyl)-N'-(4-fluorophenyl)pyrrolidine-2-carbohydrazide (PubChem CID 51935537) has the molecular formula C17H18FN3O3S and a molecular weight of 363.41 g/mol. Its IUPAC name is (2R)-1-(benzenesulfonyl)-N'-(4-fluorophenyl)pyrrolidine-2-carbohydrazide.
| Compound Name | (2R)-1-(benzenesulfonyl)-N'-(4-fluorophenyl)pyrrolidine-2-carbohydrazide |
|---|---|
| PubChem CID | 51935537 |
| Molecular Formula | C17H18FN3O3S |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2R)-1-(benzenesulfonyl)-N'-(4-fluorophenyl)pyrrolidine-2-carbohydrazide |
| SMILES | O=C(NNc1ccc(F)cc1)[C@H]1CCCN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H18FN3O3S/c18-13-8-10-14(11-9-13)19-20-17(22)16-7-4-12-21(16)25(23,24)15-5-2-1-3-6-15/h1-3,5-6,8-11,16,19H,4,7,12H2,(H,20,22)/t16-/m1/s1 |
| InChIKey | AFLMUMSZKYKNDK-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|