C10H8Cl2FNO — CID 82889777
N-(2,6-dichloro-4-fluorophenyl)cyclopropanecarboxamide (PubChem CID 82889777) has the molecular formula C10H8Cl2FNO and a molecular weight of 248.08 g/mol. Its IUPAC name is N-(2,6-dichloro-4-fluorophenyl)cyclopropanecarboxamide.
| Compound Name | N-(2,6-dichloro-4-fluorophenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 82889777 |
| Molecular Formula | C10H8Cl2FNO |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | N-(2,6-dichloro-4-fluorophenyl)cyclopropanecarboxamide |
| SMILES | O=C(Nc1c(Cl)cc(F)cc1Cl)C1CC1 |
| InChI | InChI=1S/C10H8Cl2FNO/c11-7-3-6(13)4-8(12)9(7)14-10(15)5-1-2-5/h3-5H,1-2H2,(H,14,15) |
| InChIKey | YPEQPYZOHWHQFH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |