C13H17Cl2FN2O — CID 122672313
4-amino-N-(2-chloro-4-fluorophenyl)cyclohexane-1-carboxamide;hydrochloride (PubChem CID 122672313) has the molecular formula C13H17Cl2FN2O and a molecular weight of 307.20 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-4-fluorophenyl)cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 4-amino-N-(2-chloro-4-fluorophenyl)cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 122672313 |
| Molecular Formula | C13H17Cl2FN2O |
| Molecular Weight | 307.20 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 4-amino-N-(2-chloro-4-fluorophenyl)cyclohexane-1-carboxamide;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)Nc2ccc(F)cc2Cl)CC1 |
| InChI | InChI=1S/C13H16ClFN2O.ClH/c14-11-7-9(15)3-6-12(11)17-13(18)8-1-4-10(16)5-2-8;/h3,6-8,10H,1-2,4-5,16H2,(H,17,18);1H |
| InChIKey | VFGABXLIYHDKFF-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |