C13H11F4NO — CID 107646142
N-(2,3,5,6-tetrafluorophenyl)bicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 107646142) has the molecular formula C13H11F4NO and a molecular weight of 273.23 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)bicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)bicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 107646142 |
| Molecular Formula | C13H11F4NO |
| Molecular Weight | 273.23 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)bicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)C1CC2CC2C1 |
| InChI | InChI=1S/C13H11F4NO/c14-8-4-9(15)11(17)12(10(8)16)18-13(19)7-2-5-1-6(5)3-7/h4-7H,1-3H2,(H,18,19) |
| InChIKey | DXFDXQPVPMLRMF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.23 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|