C13H12F4N2O — CID 107641674
N-(2,3,5,6-tetrafluorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 107641674) has the molecular formula C13H12F4N2O and a molecular weight of 288.24 g/mol. Its IUPAC name is N-(2,3,5,6-tetrafluorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(2,3,5,6-tetrafluorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 107641674 |
| Molecular Formula | C13H12F4N2O |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | N-(2,3,5,6-tetrafluorophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)C1CC2CCC1N2 |
| InChI | InChI=1S/C13H12F4N2O/c14-7-4-8(15)11(17)12(10(7)16)19-13(20)6-3-5-1-2-9(6)18-5/h4-6,9,18H,1-3H2,(H,19,20) |
| InChIKey | NZZWEZJRTOWZNY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|