C13H12F3NO — CID 116576075
7-azabicyclo[2.2.1]heptan-2-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 116576075) has the molecular formula C13H12F3NO and a molecular weight of 255.24 g/mol. Its IUPAC name is 7-azabicyclo[2.2.1]heptan-2-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | 7-azabicyclo[2.2.1]heptan-2-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 116576075 |
| Molecular Formula | C13H12F3NO |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 7-azabicyclo[2.2.1]heptan-2-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)C1CC2CCC1N2 |
| InChI | InChI=1S/C13H12F3NO/c14-9-3-2-7(11(15)12(9)16)13(18)8-5-6-1-4-10(8)17-6/h2-3,6,8,10,17H,1,4-5H2 |
| InChIKey | QHNSUFDGMRKRAO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|