C11H9F3OS — CID 115824372
thiolan-3-yl-(2,3,4-trifluorophenyl)methanone (PubChem CID 115824372) has the molecular formula C11H9F3OS and a molecular weight of 246.25 g/mol. Its IUPAC name is thiolan-3-yl-(2,3,4-trifluorophenyl)methanone.
| Compound Name | thiolan-3-yl-(2,3,4-trifluorophenyl)methanone |
|---|---|
| PubChem CID | 115824372 |
| Molecular Formula | C11H9F3OS |
| Molecular Weight | 246.25 g/mol |
| Exact Mass | 246.03 |
| IUPAC Name | thiolan-3-yl-(2,3,4-trifluorophenyl)methanone |
| SMILES | O=C(c1ccc(F)c(F)c1F)C1CCSC1 |
| InChI | InChI=1S/C11H9F3OS/c12-8-2-1-7(9(13)10(8)14)11(15)6-3-4-16-5-6/h1-2,6H,3-5H2 |
| InChIKey | JHGOZCSLLJNMIO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|