C12H9F3O — CID 139626805
(E)-3-cyclopropyl-3-(2,3,4-trifluorophenyl)prop-2-enal (PubChem CID 139626805) has the molecular formula C12H9F3O and a molecular weight of 226.20 g/mol. Its IUPAC name is (E)-3-cyclopropyl-3-(2,3,4-trifluorophenyl)prop-2-enal.
| Compound Name | (E)-3-cyclopropyl-3-(2,3,4-trifluorophenyl)prop-2-enal |
|---|---|
| PubChem CID | 139626805 |
| Molecular Formula | C12H9F3O |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | (E)-3-cyclopropyl-3-(2,3,4-trifluorophenyl)prop-2-enal |
| SMILES | O=C/C=C(/c1ccc(F)c(F)c1F)C1CC1 |
| InChI | InChI=1S/C12H9F3O/c13-10-4-3-9(11(14)12(10)15)8(5-6-16)7-1-2-7/h3-7H,1-2H2/b8-5+ |
| InChIKey | WVTDAKPUZRTRSE-VMPITWQZSA-N |
| XLogP | 3.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|