C11H14N4O2 — CID 116786997
N-(6-oxo-1H-pyridazin-3-yl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 116786997) has the molecular formula C11H14N4O2 and a molecular weight of 234.26 g/mol. Its IUPAC name is N-(6-oxo-1H-pyridazin-3-yl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(6-oxo-1H-pyridazin-3-yl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 116786997 |
| Molecular Formula | C11H14N4O2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | N-(6-oxo-1H-pyridazin-3-yl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1ccc(=O)[nH]n1)C1CC2CCC1N2 |
| InChI | InChI=1S/C11H14N4O2/c16-10-4-3-9(14-15-10)13-11(17)7-5-6-1-2-8(7)12-6/h3-4,6-8,12H,1-2,5H2,(H,15,16)(H,13,14,17) |
| InChIKey | FCOLVCNMGWPKMR-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |