C12H18N4O2 — CID 104963823
4-(aminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)cyclohexane-1-carboxamide (PubChem CID 104963823) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 4-(aminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)cyclohexane-1-carboxamide.
| Compound Name | 4-(aminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 104963823 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 4-(aminomethyl)-N-(6-oxo-1H-pyridazin-3-yl)cyclohexane-1-carboxamide |
| SMILES | NCC1CCC(C(=O)Nc2ccc(=O)[nH]n2)CC1 |
| InChI | InChI=1S/C12H18N4O2/c13-7-8-1-3-9(4-2-8)12(18)14-10-5-6-11(17)16-15-10/h5-6,8-9H,1-4,7,13H2,(H,16,17)(H,14,15,18) |
| InChIKey | CAHRBYREUXTVEC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |