C13H13F2N3O3 — CID 81308396
N-(2,4-difluoro-6-nitrophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 81308396) has the molecular formula C13H13F2N3O3 and a molecular weight of 297.26 g/mol. Its IUPAC name is N-(2,4-difluoro-6-nitrophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | N-(2,4-difluoro-6-nitrophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 81308396 |
| Molecular Formula | C13H13F2N3O3 |
| Molecular Weight | 297.26 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | N-(2,4-difluoro-6-nitrophenyl)-7-azabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(Nc1c(F)cc(F)cc1[N+](=O)[O-])C1CC2CCC1N2 |
| InChI | InChI=1S/C13H13F2N3O3/c14-6-3-9(15)12(11(4-6)18(20)21)17-13(19)8-5-7-1-2-10(8)16-7/h3-4,7-8,10,16H,1-2,5H2,(H,17,19) |
| InChIKey | OHBZMAUOIKZZKP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|