C19H23N3O6S — CID 8581181
[2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 8581181) has the molecular formula C19H23N3O6S and a molecular weight of 421.48 g/mol. Its IUPAC name is [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 8581181 |
| Molecular Formula | C19H23N3O6S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.13 |
| IUPAC Name | [2-(5-acetamido-2-methoxyanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | COc1ccc(NC(C)=O)cc1NC(=O)COC(=O)[C@@H]1CS[C@]2(C)CCC(=O)N12 |
| InChI | InChI=1S/C19H23N3O6S/c1-11(23)20-12-4-5-15(27-3)13(8-12)21-16(24)9-28-18(26)14-10-29-19(2)7-6-17(25)22(14)19/h4-5,8,14H,6-7,9-10H2,1-3H3,(H,20,23)(H,21,24)/t14-,19+/m0/s1 |
| InChIKey | GGNCZPMMGOKKRB-IFXJQAMLSA-N |
| XLogP | 1.59 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |