C16H16F2N2O4S — CID 7823177
[2-(2,4-difluoroanilino)-2-oxoethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823177) has the molecular formula C16H16F2N2O4S and a molecular weight of 370.38 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823177 |
| Molecular Formula | C16H16F2N2O4S |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (3S,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@]12CCC(=O)N1[C@@H](C(=O)OCC(=O)Nc1ccc(F)cc1F)CS2 |
| InChI | InChI=1S/C16H16F2N2O4S/c1-16-5-4-14(22)20(16)12(8-25-16)15(23)24-7-13(21)19-11-3-2-9(17)6-10(11)18/h2-3,6,12H,4-5,7-8H2,1H3,(H,19,21)/t12-,16+/m1/s1 |
| InChIKey | PHGIHVZXHFGUEG-WBMJQRKESA-N |
| XLogP | 1.90 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |