C21H24F3N3O5S — CID 2418420
[2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 2418420) has the molecular formula C21H24F3N3O5S and a molecular weight of 487.50 g/mol. Its IUPAC name is [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 2418420 |
| Molecular Formula | C21H24F3N3O5S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [2-[2-morpholin-4-yl-5-(trifluoromethyl)anilino]-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | C[C@@]12CCC(=O)N1[C@H](C(=O)OCC(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)CS2 |
| InChI | InChI=1S/C21H24F3N3O5S/c1-20-5-4-18(29)27(20)16(12-33-20)19(30)32-11-17(28)25-14-10-13(21(22,23)24)2-3-15(14)26-6-8-31-9-7-26/h2-3,10,16H,4-9,11-12H2,1H3,(H,25,28)/t16-,20+/m0/s1 |
| InChIKey | GVHBLELUCWTPKL-OXJNMPFZSA-N |
| XLogP | 2.48 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |