C21H27N3O7S2 — CID 41117906
[2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 41117906) has the molecular formula C21H27N3O7S2 and a molecular weight of 497.60 g/mol. Its IUPAC name is [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 41117906 |
| Molecular Formula | C21H27N3O7S2 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | [2-(4-methyl-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C21H27N3O7S2/c1-14-3-4-15(11-17(14)33(28,29)23-7-9-30-10-8-23)22-18(25)12-31-20(27)16-13-32-21(2)6-5-19(26)24(16)21/h3-4,11,16H,5-10,12-13H2,1-2H3,(H,22,25)/t16-,21-/m0/s1 |
| InChIKey | CWBRKWGIHDVXDH-KKSFZXQISA-N |
| XLogP | 0.95 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |