C19H22F3N3O3S — CID 30825440
(3R,7aS)-7a-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide (PubChem CID 30825440) has the molecular formula C19H22F3N3O3S and a molecular weight of 429.46 g/mol. Its IUPAC name is (3R,7aS)-7a-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide.
| Compound Name | (3R,7aS)-7a-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
|---|---|
| PubChem CID | 30825440 |
| Molecular Formula | C19H22F3N3O3S |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (3R,7aS)-7a-methyl-N-[2-morpholin-4-yl-5-(trifluoromethyl)phenyl]-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxamide |
| SMILES | C[C@]12CCC(=O)N1[C@H](C(=O)Nc1cc(C(F)(F)F)ccc1N1CCOCC1)CS2 |
| InChI | InChI=1S/C19H22F3N3O3S/c1-18-5-4-16(26)25(18)15(11-29-18)17(27)23-13-10-12(19(20,21)22)2-3-14(13)24-6-8-28-9-7-24/h2-3,10,15H,4-9,11H2,1H3,(H,23,27)/t15-,18-/m0/s1 |
| InChIKey | BQPONQOFTKTVRG-YJBOKZPZSA-N |
| XLogP | 2.93 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |